3-Metilheptana
3-Metilheptana adalah alkana bercabang yang merupakan isomer dari oktana. Mempunyai rumus kimia CH3CH2CH(CH3)CH2CH2CH2CH3.
 | |
 | |
| Nama | |
|---|---|
| Nama IUPAC
3-Metilheptana[1] | |
| Nama lain
2-Ethylhexane
| |
| Penanda | |
Model 3D (JSmol) |
|
| 3DMet | {{{3DMet}}} |
| Referensi Beilstein | 1730777 |
| ChemSpider | |
| Nomor EC | |
PubChem CID |
|
| Nomor RTECS | {{{value}}} |
| Nomor UN | 1262 |
CompTox Dashboard (EPA) |
|
| |
| |
| Sifat | |
| C8H18 | |
| Massa molar | 114,23 g·mol−1 |
| Penampilan | Tidak berwarna, cairan transparan |
| Bau | Tidak berbau |
| Densitas | 705 mg mL−1 |
| Tekanan uap | 5.0 kPa (at 37.7 °C) |
| kH | 2.7 nmol Pa−1 kg−1 |
| Indeks bias (nD) | 1.398–1.399 |
| Termokimia | |
| Kapasitas kalor (C) | 250.20 J K−1 mol−1 |
| Entropi molar standar (S |
362.6 J K−1 mol−1 |
| Entalpi pembentukan standar (ΔfH |
−253.6–−251.4 kJ mol−1 |
| Entalpi pembakaran standar ΔcH |
−5469.5–−5466.9 kJ mol−1 |
| Bahaya | |
| Piktogram GHS |     |
| Keterangan bahaya GHS | {{{value}}} |
Pernyataan bahaya GHS |
H225, H304, H315, H336, H410 |
Langkah perlindungan GHS |
P210, P261, P273, P301+310, P331 |
| Titik nyala | 7.2 °C |
| Ambang ledakan | 0.98–?% |
| Senyawa terkait | |
Kecuali dinyatakan lain, data di atas berlaku pada temperatur dan tekanan standar (25 °C [77 °F], 100 kPa). | |
 verifikasi (apa ini  ?) | |
| Referensi | |
Referensi
- "3-METHYLHEPTANE - Compound Summary". PubChem Compound. USA: National Center for Biotechnology Information. 26 March 2005. Identification and Related Records. Diakses tanggal 8 March 2012.
Pranala luar
- Non-stereospecific oxidation of DL-3-methylheptane by aPseudomonas
- Physical and chemical properties table Diarsipkan 2008-03-13 di Wayback Machine.
Pengawasan otoritas  |
|---|
This article is issued from Wikipedia. The text is licensed under Creative Commons - Attribution - Sharealike. Additional terms may apply for the media files.